C18H24F8O4 — CID 91742888
1-O-(2,2,3,3,4,4,5,5-octafluoropentyl) 5-O-oct-1-en-3-yl pentanedioate (PubChem CID 91742888) has the molecular formula C18H24F8O4 and a molecular weight of 456.37 g/mol. Its IUPAC name is 1-O-(2,2,3,3,4,4,5,5-octafluoropentyl) 5-O-oct-1-en-3-yl pentanedioate.
| Compound Name | 1-O-(2,2,3,3,4,4,5,5-octafluoropentyl) 5-O-oct-1-en-3-yl pentanedioate |
|---|---|
| PubChem CID | 91742888 |
| Molecular Formula | C18H24F8O4 |
| Molecular Weight | 456.37 g/mol |
| Exact Mass | 456.15 |
| IUPAC Name | 1-O-(2,2,3,3,4,4,5,5-octafluoropentyl) 5-O-oct-1-en-3-yl pentanedioate |
| SMILES | C=CC(CCCCC)OC(=O)CCCC(=O)OCC(F)(F)C(F)(F)C(F)(F)C(F)F |
| InChI | InChI=1S/C18H24F8O4/c1-3-5-6-8-12(4-2)30-14(28)10-7-9-13(27)29-11-16(21,22)18(25,26)17(23,24)15(19)20/h4,12,15H,2-3,5-11H2,1H3 |
| InChIKey | MCCVSESGNIDAFN-UHFFFAOYSA-N |
| XLogP | 5.55 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.37 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|