C15H10F5NO2 — CID 91742966
[4-(dimethylamino)-2-hydroxyphenyl]-(2,3,4,5,6-pentafluorophenyl)methanone (PubChem CID 91742966) has the molecular formula C15H10F5NO2 and a molecular weight of 331.24 g/mol. Its IUPAC name is [4-(dimethylamino)-2-hydroxyphenyl]-(2,3,4,5,6-pentafluorophenyl)methanone.
| Compound Name | [4-(dimethylamino)-2-hydroxyphenyl]-(2,3,4,5,6-pentafluorophenyl)methanone |
|---|---|
| PubChem CID | 91742966 |
| Molecular Formula | C15H10F5NO2 |
| Molecular Weight | 331.24 g/mol |
| Exact Mass | 331.06 |
| IUPAC Name | [4-(dimethylamino)-2-hydroxyphenyl]-(2,3,4,5,6-pentafluorophenyl)methanone |
| SMILES | CN(C)c1ccc(C(=O)c2c(F)c(F)c(F)c(F)c2F)c(O)c1 |
| InChI | InChI=1S/C15H10F5NO2/c1-21(2)6-3-4-7(8(22)5-6)15(23)9-10(16)12(18)14(20)13(19)11(9)17/h3-5,22H,1-2H3 |
| InChIKey | LVECKPTZYHSRSS-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.24 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|