C15H13ClF5NO2 — CID 91743033
N-[1-(2-chlorophenyl)-2-oxocyclohexyl]-2,2,3,3,3-pentafluoropropanamide (PubChem CID 91743033) has the molecular formula C15H13ClF5NO2 and a molecular weight of 369.72 g/mol. Its IUPAC name is N-[1-(2-chlorophenyl)-2-oxocyclohexyl]-2,2,3,3,3-pentafluoropropanamide.
| Compound Name | N-[1-(2-chlorophenyl)-2-oxocyclohexyl]-2,2,3,3,3-pentafluoropropanamide |
|---|---|
| PubChem CID | 91743033 |
| Molecular Formula | C15H13ClF5NO2 |
| Molecular Weight | 369.72 g/mol |
| Exact Mass | 369.06 |
| IUPAC Name | N-[1-(2-chlorophenyl)-2-oxocyclohexyl]-2,2,3,3,3-pentafluoropropanamide |
| SMILES | O=C1CCCCC1(NC(=O)C(F)(F)C(F)(F)F)c1ccccc1Cl |
| InChI | InChI=1S/C15H13ClF5NO2/c16-10-6-2-1-5-9(10)13(8-4-3-7-11(13)23)22-12(24)14(17,18)15(19,20)21/h1-2,5-6H,3-4,7-8H2,(H,22,24) |
| InChIKey | FZABMXSIMYLCHF-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.72 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|