C20H8F14O6S — CID 91743109
[4-[4-(2,2,3,3,4,4,4-heptafluorobutanoyloxy)phenyl]sulfonylphenyl] 2,2,3,3,4,4,4-heptafluorobutanoate (PubChem CID 91743109) has the molecular formula C20H8F14O6S and a molecular weight of 642.32 g/mol. Its IUPAC name is [4-[4-(2,2,3,3,4,4,4-heptafluorobutanoyloxy)phenyl]sulfonylphenyl] 2,2,3,3,4,4,4-heptafluorobutanoate.
| Compound Name | [4-[4-(2,2,3,3,4,4,4-heptafluorobutanoyloxy)phenyl]sulfonylphenyl] 2,2,3,3,4,4,4-heptafluorobutanoate |
|---|---|
| PubChem CID | 91743109 |
| Molecular Formula | C20H8F14O6S |
| Molecular Weight | 642.32 g/mol |
| Exact Mass | 641.98 |
| IUPAC Name | [4-[4-(2,2,3,3,4,4,4-heptafluorobutanoyloxy)phenyl]sulfonylphenyl] 2,2,3,3,4,4,4-heptafluorobutanoate |
| SMILES | O=C(Oc1ccc(S(=O)(=O)c2ccc(OC(=O)C(F)(F)C(F)(F)C(F)(F)F)cc2)cc1)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C20H8F14O6S/c21-15(22,17(25,26)19(29,30)31)13(35)39-9-1-5-11(6-2-9)41(37,38)12-7-3-10(4-8-12)40-14(36)16(23,24)18(27,28)20(32,33)34/h1-8H |
| InChIKey | ZQJHQHZUVTZYAI-UHFFFAOYSA-N |
| XLogP | 6.00 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 642.32 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|