C17H24F8O4 — CID 91743331
1-O-(4-methylpentyl) 6-O-(2,2,3,3,4,4,5,5-octafluoropentyl) hexanedioate (PubChem CID 91743331) has the molecular formula C17H24F8O4 and a molecular weight of 444.36 g/mol. Its IUPAC name is 1-O-(4-methylpentyl) 6-O-(2,2,3,3,4,4,5,5-octafluoropentyl) hexanedioate.
| Compound Name | 1-O-(4-methylpentyl) 6-O-(2,2,3,3,4,4,5,5-octafluoropentyl) hexanedioate |
|---|---|
| PubChem CID | 91743331 |
| Molecular Formula | C17H24F8O4 |
| Molecular Weight | 444.36 g/mol |
| Exact Mass | 444.15 |
| IUPAC Name | 1-O-(4-methylpentyl) 6-O-(2,2,3,3,4,4,5,5-octafluoropentyl) hexanedioate |
| SMILES | CC(C)CCCOC(=O)CCCCC(=O)OCC(F)(F)C(F)(F)C(F)(F)C(F)F |
| InChI | InChI=1S/C17H24F8O4/c1-11(2)6-5-9-28-12(26)7-3-4-8-13(27)29-10-15(20,21)17(24,25)16(22,23)14(18)19/h11,14H,3-10H2,1-2H3 |
| InChIKey | HSJFXNBLURQLBE-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.36 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|