C27H23N2O3+ — CID 91743399
methyl (E)-2-methyl-3-[9-methyl-3-(pyridin-2-ylmethyl)-11-oxa-12-azoniatetracyclo[8.7.0.02,7.012,17]heptadeca-1(10),2(7),3,5,8,12,14,16-octaen-4-yl]prop-2-enoate (PubChem CID 91743399) has the molecular formula C27H23N2O3+ and a molecular weight of 423.49 g/mol. Its IUPAC name is methyl (E)-2-methyl-3-[9-methyl-3-(pyridin-2-ylmethyl)-11-oxa-12-azoniatetracyclo[8.7.0.02,7.012,17]heptadeca-1(10),2(7),3,5,8,12,14,16-octaen-4-yl]prop-2-enoate.
| Compound Name | methyl (E)-2-methyl-3-[9-methyl-3-(pyridin-2-ylmethyl)-11-oxa-12-azoniatetracyclo[8.7.0.02,7.012,17]heptadeca-1(10),2(7),3,5,8,12,14,16-octaen-4-yl]prop-2-enoate |
|---|---|
| PubChem CID | 91743399 |
| Molecular Formula | C27H23N2O3+ |
| Molecular Weight | 423.49 g/mol |
| Exact Mass | 423.17 |
| IUPAC Name | methyl (E)-2-methyl-3-[9-methyl-3-(pyridin-2-ylmethyl)-11-oxa-12-azoniatetracyclo[8.7.0.02,7.012,17]heptadeca-1(10),2(7),3,5,8,12,14,16-octaen-4-yl]prop-2-enoate |
| SMILES | COC(=O)/C(C)=C/c1ccc2cc(C)c3o[n+]4ccccc4c3c2c1Cc1ccccn1 |
| InChI | InChI=1S/C27H23N2O3/c1-17-14-20-11-10-19(15-18(2)27(30)31-3)22(16-21-8-4-6-12-28-21)24(20)25-23-9-5-7-13-29(23)32-26(17)25/h4-15H,16H2,1-3H3/q+1/b18-15+ |
| InChIKey | VVMWPPRWBDSMLT-OBGWFSINSA-N |
| XLogP | 5.20 |
| TPSA | 56.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.49 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|