C14H6F24O — CID 91743406
1,1,1,2,3,4,5,5,5-nonafluoro-2-[[2,3,4,5,5,5-hexafluoro-2,4-bis(trifluoromethyl)pentoxy]methyl]-4-(trifluoromethyl)pentane (PubChem CID 91743406) has the molecular formula C14H6F24O and a molecular weight of 646.15 g/mol. Its IUPAC name is 1,1,1,2,3,4,5,5,5-nonafluoro-2-[[2,3,4,5,5,5-hexafluoro-2,4-bis(trifluoromethyl)pentoxy]methyl]-4-(trifluoromethyl)pentane.
| Compound Name | 1,1,1,2,3,4,5,5,5-nonafluoro-2-[[2,3,4,5,5,5-hexafluoro-2,4-bis(trifluoromethyl)pentoxy]methyl]-4-(trifluoromethyl)pentane |
|---|---|
| PubChem CID | 91743406 |
| Molecular Formula | C14H6F24O |
| Molecular Weight | 646.15 g/mol |
| Exact Mass | 646.00 |
| IUPAC Name | 1,1,1,2,3,4,5,5,5-nonafluoro-2-[[2,3,4,5,5,5-hexafluoro-2,4-bis(trifluoromethyl)pentoxy]methyl]-4-(trifluoromethyl)pentane |
| SMILES | FC(C(F)(COCC(F)(C(F)C(F)(C(F)(F)F)C(F)(F)F)C(F)(F)F)C(F)(F)F)C(F)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C14H6F24O/c15-3(7(19,11(27,28)29)12(30,31)32)5(17,9(21,22)23)1-39-2-6(18,10(24,25)26)4(16)8(20,13(33,34)35)14(36,37)38/h3-4H,1-2H2 |
| InChIKey | STPAUSJOKHVTEN-UHFFFAOYSA-N |
| XLogP | 7.89 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 646.15 |
| LogP ≤ 5 | 7.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |