C21H25NO4 — CID 91743656
(9-ethoxy-3-methyl-2,4,4a,7,7a,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-7-yl) acetate (PubChem CID 91743656) has the molecular formula C21H25NO4 and a molecular weight of 355.43 g/mol. Its IUPAC name is (9-ethoxy-3-methyl-2,4,4a,7,7a,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-7-yl) acetate.
| Compound Name | (9-ethoxy-3-methyl-2,4,4a,7,7a,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-7-yl) acetate |
|---|---|
| PubChem CID | 91743656 |
| Molecular Formula | C21H25NO4 |
| Molecular Weight | 355.43 g/mol |
| Exact Mass | 355.18 |
| IUPAC Name | (9-ethoxy-3-methyl-2,4,4a,7,7a,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-7-yl) acetate |
| SMILES | CCOc1ccc2c3c1OC1C(OC(C)=O)C=CC4C(C2)N(C)CCC341 |
| InChI | InChI=1S/C21H25NO4/c1-4-24-16-7-5-13-11-15-14-6-8-17(25-12(2)23)20-21(14,9-10-22(15)3)18(13)19(16)26-20/h5-8,14-15,17,20H,4,9-11H2,1-3H3 |
| InChIKey | DLMBQCVWDSCRAH-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.43 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|