C16H19F5O3SSi — CID 91743749
[tert-butyl(dimethyl)silyl] 3-(2,2,3,3,3-pentafluoropropanoylsulfanyl)benzoate (PubChem CID 91743749) has the molecular formula C16H19F5O3SSi and a molecular weight of 414.47 g/mol. Its IUPAC name is [tert-butyl(dimethyl)silyl] 3-(2,2,3,3,3-pentafluoropropanoylsulfanyl)benzoate.
| Compound Name | [tert-butyl(dimethyl)silyl] 3-(2,2,3,3,3-pentafluoropropanoylsulfanyl)benzoate |
|---|---|
| PubChem CID | 91743749 |
| Molecular Formula | C16H19F5O3SSi |
| Molecular Weight | 414.47 g/mol |
| Exact Mass | 414.07 |
| IUPAC Name | [tert-butyl(dimethyl)silyl] 3-(2,2,3,3,3-pentafluoropropanoylsulfanyl)benzoate |
| SMILES | CC(C)(C)[Si](C)(C)OC(=O)c1cccc(SC(=O)C(F)(F)C(F)(F)F)c1 |
| InChI | InChI=1S/C16H19F5O3SSi/c1-14(2,3)26(4,5)24-12(22)10-7-6-8-11(9-10)25-13(23)15(17,18)16(19,20)21/h6-9H,1-5H3 |
| InChIKey | KKUJCVLFTOXYQO-UHFFFAOYSA-N |
| XLogP | 5.66 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.47 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|