C20H46N4Si3 — CID 91744083
N,N,2-tris[tert-butyl(dimethyl)silyl]-1,2,4-triazol-3-amine (PubChem CID 91744083) has the molecular formula C20H46N4Si3 and a molecular weight of 426.87 g/mol. Its IUPAC name is N,N,2-tris[tert-butyl(dimethyl)silyl]-1,2,4-triazol-3-amine.
| Compound Name | N,N,2-tris[tert-butyl(dimethyl)silyl]-1,2,4-triazol-3-amine |
|---|---|
| PubChem CID | 91744083 |
| Molecular Formula | C20H46N4Si3 |
| Molecular Weight | 426.87 g/mol |
| Exact Mass | 426.30 |
| IUPAC Name | N,N,2-tris[tert-butyl(dimethyl)silyl]-1,2,4-triazol-3-amine |
| SMILES | CC(C)(C)[Si](C)(C)N(c1ncnn1[Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C20H46N4Si3/c1-18(2,3)25(10,11)23-17(21-16-22-23)24(26(12,13)19(4,5)6)27(14,15)20(7,8)9/h16H,1-15H3 |
| InChIKey | ULNSOTRESSNLPZ-UHFFFAOYSA-N |
| XLogP | 6.95 |
| TPSA | 33.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.87 |
| LogP ≤ 5 | 6.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|