C26H42O2Si — CID 91744201
1-[(8S,9S,10R,13S,14S,17S)-3-[dimethyl(prop-2-enyl)silyl]oxy-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]ethanone (PubChem CID 91744201) has the molecular formula C26H42O2Si and a molecular weight of 414.71 g/mol. Its IUPAC name is 1-[(8S,9S,10R,13S,14S,17S)-3-[dimethyl(prop-2-enyl)silyl]oxy-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]ethanone.
| Compound Name | 1-[(8S,9S,10R,13S,14S,17S)-3-[dimethyl(prop-2-enyl)silyl]oxy-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]ethanone |
|---|---|
| PubChem CID | 91744201 |
| Molecular Formula | C26H42O2Si |
| Molecular Weight | 414.71 g/mol |
| Exact Mass | 414.30 |
| IUPAC Name | 1-[(8S,9S,10R,13S,14S,17S)-3-[dimethyl(prop-2-enyl)silyl]oxy-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]ethanone |
| SMILES | C=CC[Si](C)(C)OC1CC[C@@]2(C)C(=CC[C@H]3[C@@H]4CC[C@H](C(C)=O)[C@@]4(C)CC[C@@H]32)C1 |
| InChI | InChI=1S/C26H42O2Si/c1-7-16-29(5,6)28-20-12-14-25(3)19(17-20)8-9-21-23-11-10-22(18(2)27)26(23,4)15-13-24(21)25/h7-8,20-24H,1,9-17H2,2-6H3/t20?,21-,22+,23-,24-,25-,26+/m0/s1 |
| InChIKey | OEPZKUFNKWBSOF-FQSLQXOSSA-N |
| XLogP | 6.93 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.71 |
| LogP ≤ 5 | 6.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|