C20H27ClF3NO2Si — CID 91744234
N-[tert-butyl(dimethyl)silyl]-N-[1-(2-chlorophenyl)-2-oxocyclohexyl]-2,2,2-trifluoroacetamide (PubChem CID 91744234) has the molecular formula C20H27ClF3NO2Si and a molecular weight of 433.97 g/mol. Its IUPAC name is N-[tert-butyl(dimethyl)silyl]-N-[1-(2-chlorophenyl)-2-oxocyclohexyl]-2,2,2-trifluoroacetamide.
| Compound Name | N-[tert-butyl(dimethyl)silyl]-N-[1-(2-chlorophenyl)-2-oxocyclohexyl]-2,2,2-trifluoroacetamide |
|---|---|
| PubChem CID | 91744234 |
| Molecular Formula | C20H27ClF3NO2Si |
| Molecular Weight | 433.97 g/mol |
| Exact Mass | 433.15 |
| IUPAC Name | N-[tert-butyl(dimethyl)silyl]-N-[1-(2-chlorophenyl)-2-oxocyclohexyl]-2,2,2-trifluoroacetamide |
| SMILES | CC(C)(C)[Si](C)(C)N(C(=O)C(F)(F)F)C1(c2ccccc2Cl)CCCCC1=O |
| InChI | InChI=1S/C20H27ClF3NO2Si/c1-18(2,3)28(4,5)25(17(27)20(22,23)24)19(13-9-8-12-16(19)26)14-10-6-7-11-15(14)21/h6-7,10-11H,8-9,12-13H2,1-5H3 |
| InChIKey | ZIPILSGVIXTDFM-UHFFFAOYSA-N |
| XLogP | 6.07 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.97 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|