C29H44 — CID 91744586
1,2,4a,6a,6b,9,12a-heptamethyl-1,2,3,4,5,6,7,8,8a,11,12,14b-dodecahydropicene (PubChem CID 91744586) has the molecular formula C29H44 and a molecular weight of 392.67 g/mol. Its IUPAC name is 1,2,4a,6a,6b,9,12a-heptamethyl-1,2,3,4,5,6,7,8,8a,11,12,14b-dodecahydropicene.
| Compound Name | 1,2,4a,6a,6b,9,12a-heptamethyl-1,2,3,4,5,6,7,8,8a,11,12,14b-dodecahydropicene |
|---|---|
| PubChem CID | 91744586 |
| Molecular Formula | C29H44 |
| Molecular Weight | 392.67 g/mol |
| Exact Mass | 392.34 |
| IUPAC Name | 1,2,4a,6a,6b,9,12a-heptamethyl-1,2,3,4,5,6,7,8,8a,11,12,14b-dodecahydropicene |
| SMILES | CC1=CCCC2(C)C3=CC=C4C5C(C)C(C)CCC5(C)CCC4(C)C3(C)CCC12 |
| InChI | InChI=1S/C29H44/c1-19-12-15-26(4)17-18-28(6)23(25(26)21(19)3)10-11-24-27(5)14-8-9-20(2)22(27)13-16-29(24,28)7/h9-11,19,21-22,25H,8,12-18H2,1-7H3 |
| InChIKey | QSFCELCDWHMMTE-UHFFFAOYSA-N |
| XLogP | 8.50 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.67 |
| LogP ≤ 5 | 8.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|