C19H31Cl3O2Si — CID 91744665
diethyl-nonoxy-(2,3,6-trichlorophenoxy)silane (PubChem CID 91744665) has the molecular formula C19H31Cl3O2Si and a molecular weight of 425.90 g/mol. Its IUPAC name is diethyl-nonoxy-(2,3,6-trichlorophenoxy)silane.
| Compound Name | diethyl-nonoxy-(2,3,6-trichlorophenoxy)silane |
|---|---|
| PubChem CID | 91744665 |
| Molecular Formula | C19H31Cl3O2Si |
| Molecular Weight | 425.90 g/mol |
| Exact Mass | 424.12 |
| IUPAC Name | diethyl-nonoxy-(2,3,6-trichlorophenoxy)silane |
| SMILES | CCCCCCCCCO[Si](CC)(CC)Oc1c(Cl)ccc(Cl)c1Cl |
| InChI | InChI=1S/C19H31Cl3O2Si/c1-4-7-8-9-10-11-12-15-23-25(5-2,6-3)24-19-17(21)14-13-16(20)18(19)22/h13-14H,4-12,15H2,1-3H3 |
| InChIKey | DXHKSNBWAFTMIJ-UHFFFAOYSA-N |
| XLogP | 8.27 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.90 |
| LogP ≤ 5 | 8.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|