C20H31F5O2Si — CID 91744672
diethyl-nonoxy-[(2,3,4,5,6-pentafluorophenyl)methoxy]silane (PubChem CID 91744672) has the molecular formula C20H31F5O2Si and a molecular weight of 426.54 g/mol. Its IUPAC name is diethyl-nonoxy-[(2,3,4,5,6-pentafluorophenyl)methoxy]silane.
| Compound Name | diethyl-nonoxy-[(2,3,4,5,6-pentafluorophenyl)methoxy]silane |
|---|---|
| PubChem CID | 91744672 |
| Molecular Formula | C20H31F5O2Si |
| Molecular Weight | 426.54 g/mol |
| Exact Mass | 426.20 |
| IUPAC Name | diethyl-nonoxy-[(2,3,4,5,6-pentafluorophenyl)methoxy]silane |
| SMILES | CCCCCCCCCO[Si](CC)(CC)OCc1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C20H31F5O2Si/c1-4-7-8-9-10-11-12-13-26-28(5-2,6-3)27-14-15-16(21)18(23)20(25)19(24)17(15)22/h4-14H2,1-3H3 |
| InChIKey | ZGROGCWEPOIEPE-UHFFFAOYSA-N |
| XLogP | 7.15 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.54 |
| LogP ≤ 5 | 7.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|