C18H20F15NO3 — CID 91745514
4-methylpentyl 2-[ethyl(2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-pentadecafluorooctanoyl)amino]acetate (PubChem CID 91745514) has the molecular formula C18H20F15NO3 and a molecular weight of 583.33 g/mol. Its IUPAC name is 4-methylpentyl 2-[ethyl(2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-pentadecafluorooctanoyl)amino]acetate.
| Compound Name | 4-methylpentyl 2-[ethyl(2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-pentadecafluorooctanoyl)amino]acetate |
|---|---|
| PubChem CID | 91745514 |
| Molecular Formula | C18H20F15NO3 |
| Molecular Weight | 583.33 g/mol |
| Exact Mass | 583.12 |
| IUPAC Name | 4-methylpentyl 2-[ethyl(2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-pentadecafluorooctanoyl)amino]acetate |
| SMILES | CCN(CC(=O)OCCCC(C)C)C(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C18H20F15NO3/c1-4-34(8-10(35)37-7-5-6-9(2)3)11(36)12(19,20)13(21,22)14(23,24)15(25,26)16(27,28)17(29,30)18(31,32)33/h9H,4-8H2,1-3H3 |
| InChIKey | PHSOSMLQFSNJGX-UHFFFAOYSA-N |
| XLogP | 6.19 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 583.33 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|