C20H22F15NO3 — CID 91745594
heptyl 2-(2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-pentadecafluorooctanoylamino)pent-4-enoate (PubChem CID 91745594) has the molecular formula C20H22F15NO3 and a molecular weight of 609.37 g/mol. Its IUPAC name is heptyl 2-(2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-pentadecafluorooctanoylamino)pent-4-enoate.
| Compound Name | heptyl 2-(2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-pentadecafluorooctanoylamino)pent-4-enoate |
|---|---|
| PubChem CID | 91745594 |
| Molecular Formula | C20H22F15NO3 |
| Molecular Weight | 609.37 g/mol |
| Exact Mass | 609.14 |
| IUPAC Name | heptyl 2-(2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-pentadecafluorooctanoylamino)pent-4-enoate |
| SMILES | C=CCC(NC(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)C(=O)OCCCCCCC |
| InChI | InChI=1S/C20H22F15NO3/c1-3-5-6-7-8-10-39-12(37)11(9-4-2)36-13(38)14(21,22)15(23,24)16(25,26)17(27,28)18(29,30)19(31,32)20(33,34)35/h4,11H,2-3,5-10H2,1H3,(H,36,38) |
| InChIKey | KGGDUQCPIQUZFO-UHFFFAOYSA-N |
| XLogP | 6.93 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 609.37 |
| LogP ≤ 5 | 6.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|