C31H56OSi — CID 91745675
trimethyl-[[(3S,4S,5S,9R,10S,13R,14R,17R)-4,10,13-trimethyl-17-[(2R)-6-methylheptan-2-yl]-2,3,4,5,6,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl]oxy]silane (PubChem CID 91745675) has the molecular formula C31H56OSi and a molecular weight of 472.87 g/mol. Its IUPAC name is trimethyl-[[(3S,4S,5S,9R,10S,13R,14R,17R)-4,10,13-trimethyl-17-[(2R)-6-methylheptan-2-yl]-2,3,4,5,6,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl]oxy]silane.
| Compound Name | trimethyl-[[(3S,4S,5S,9R,10S,13R,14R,17R)-4,10,13-trimethyl-17-[(2R)-6-methylheptan-2-yl]-2,3,4,5,6,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl]oxy]silane |
|---|---|
| PubChem CID | 91745675 |
| Molecular Formula | C31H56OSi |
| Molecular Weight | 472.87 g/mol |
| Exact Mass | 472.41 |
| IUPAC Name | trimethyl-[[(3S,4S,5S,9R,10S,13R,14R,17R)-4,10,13-trimethyl-17-[(2R)-6-methylheptan-2-yl]-2,3,4,5,6,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl]oxy]silane |
| SMILES | CC(C)CCC[C@@H](C)[C@H]1CC[C@H]2C3=CC[C@H]4[C@H](C)[C@@H](O[Si](C)(C)C)CC[C@]4(C)[C@H]3CC[C@]12C |
| InChI | InChI=1S/C31H56OSi/c1-21(2)11-10-12-22(3)25-15-16-27-24-13-14-26-23(4)29(32-33(7,8)9)18-20-31(26,6)28(24)17-19-30(25,27)5/h13,21-23,25-29H,10-12,14-20H2,1-9H3/t22-,23+,25-,26+,27+,28+,29+,30-,31+/m1/s1 |
| InChIKey | HWAIJKPVMLXYBA-PVRBYZKOSA-N |
| XLogP | 9.49 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.87 |
| LogP ≤ 5 | 9.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|