C18H28O6 — CID 91746270
L-chiro-Inositol, 1,2:5,6-di-O-cyclohexylidene- (PubChem CID 91746270) has the molecular formula C18H28O6 and a molecular weight of 340.42 g/mol.
| Compound Name | L-chiro-Inositol, 1,2:5,6-di-O-cyclohexylidene- |
|---|---|
| PubChem CID | 91746270 |
| Molecular Formula | C18H28O6 |
| Molecular Weight | 340.42 g/mol |
| Exact Mass | 340.19 |
| IUPAC Name | — |
| SMILES | O[C@H]1[C@H](O)[C@H]2OC3(CCCCC3)O[C@H]2[C@@H]2OC3(CCCCC3)O[C@H]12 |
| InChI | InChI=1S/C18H28O6/c19-11-12(20)14-16(24-18(22-14)9-5-2-6-10-18)15-13(11)21-17(23-15)7-3-1-4-8-17/h11-16,19-20H,1-10H2/t11-,12-,13+,14+,15+,16+/m0/s1 |
| InChIKey | PHAPESVEHHOBEI-KPRKPIBOSA-N |
| XLogP | 1.61 |
| TPSA | 77.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.42 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |