About 2-[(2,4-diamino-4-oxobutanoyl)amino]-4-methylsulfinylbutanoic acid
2-[(2,4-diamino-4-oxobutanoyl)amino]-4-methylsulfinylbutanoic acid (PubChem CID 91746315) has the molecular formula C9H17N3O5S
and a molecular weight of 279.32 g/mol. Its IUPAC name is 2-[(2,4-diamino-4-oxobutanoyl)amino]-4-methylsulfinylbutanoic acid.
Molecular Properties
| Compound Name | 2-[(2,4-diamino-4-oxobutanoyl)amino]-4-methylsulfinylbutanoic acid |
| PubChem CID | 91746315 |
| Molecular Formula | C9H17N3O5S |
| Molecular Weight | 279.32 g/mol |
| Exact Mass | 279.09 |
| IUPAC Name | 2-[(2,4-diamino-4-oxobutanoyl)amino]-4-methylsulfinylbutanoic acid |
| SMILES | CS(=O)CCC(NC(=O)C(N)CC(N)=O)C(=O)O |
| InChI | InChI=1S/C9H17N3O5S/c1-18(17)3-2-6(9(15)16)12-8(14)5(10)4-7(11)13/h5-6H,2-4,10H2,1H3,(H2,11,13)(H,12,14)(H,15,16) |
| InChIKey | URJAZMITODYBPX-UHFFFAOYSA-N |
| XLogP | -2.47 |
| TPSA | 152.58 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 279.32 |
| LogP ≤ 5 | -2.47 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-[(2,4-diamino-4-oxobutanoyl)amino]-4-methylsulfinylbutanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(2,4-diamino-4-oxobutanoyl)amino]-4-methylsulfinylbutanoic acid?
The IUPAC name of 2-[(2,4-diamino-4-oxobutanoyl)amino]-4-methylsulfinylbutanoic acid (CID 91746315) is 2-[(2,4-diamino-4-oxobutanoyl)amino]-4-methylsulfinylbutanoic acid.
What is the SMILES notation for 2-[(2,4-diamino-4-oxobutanoyl)amino]-4-methylsulfinylbutanoic acid?
The canonical SMILES for 2-[(2,4-diamino-4-oxobutanoyl)amino]-4-methylsulfinylbutanoic acid is CS(=O)CCC(NC(=O)C(N)CC(N)=O)C(=O)O.
What is the InChIKey of 2-[(2,4-diamino-4-oxobutanoyl)amino]-4-methylsulfinylbutanoic acid?
The InChIKey is URJAZMITODYBPX-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H17N3O5S/c1-18(17)3-2-6(9(15)16)12-8(14)5(10)4-7(11)13/h5-6H,2-4,10H2,1H3,(H2,11,13)(H,12,14)(H,15,16).
What are the key properties of 2-[(2,4-diamino-4-oxobutanoyl)amino]-4-methylsulfinylbutanoic acid?
2-[(2,4-diamino-4-oxobutanoyl)amino]-4-methylsulfinylbutanoic acid has a molecular weight of 279.32 g/mol, XLogP of -2.47, 8 rotatable bonds, 4 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(2,4-diamino-4-oxobutanoyl)amino]-4-methylsulfinylbutanoic acid is sourced from PubChem (CID 91746315), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).