C20H15ClN4OS — CID 9174663
3-(2-chlorophenyl)-4-[(Z)-(6-methoxynaphthalen-2-yl)methylideneamino]-1H-1,2,4-triazole-5-thione (PubChem CID 9174663) has the molecular formula C20H15ClN4OS and a molecular weight of 394.89 g/mol. Its IUPAC name is 3-(2-chlorophenyl)-4-[(Z)-(6-methoxynaphthalen-2-yl)methylideneamino]-1H-1,2,4-triazole-5-thione.
| Compound Name | 3-(2-chlorophenyl)-4-[(Z)-(6-methoxynaphthalen-2-yl)methylideneamino]-1H-1,2,4-triazole-5-thione |
|---|---|
| PubChem CID | 9174663 |
| Molecular Formula | C20H15ClN4OS |
| Molecular Weight | 394.89 g/mol |
| Exact Mass | 394.07 |
| IUPAC Name | 3-(2-chlorophenyl)-4-[(Z)-(6-methoxynaphthalen-2-yl)methylideneamino]-1H-1,2,4-triazole-5-thione |
| SMILES | COc1ccc2cc(/C=N\n3c(-c4ccccc4Cl)n[nH]c3=S)ccc2c1 |
| InChI | InChI=1S/C20H15ClN4OS/c1-26-16-9-8-14-10-13(6-7-15(14)11-16)12-22-25-19(23-24-20(25)27)17-4-2-3-5-18(17)21/h2-12H,1H3,(H,24,27)/b22-12- |
| InChIKey | VURUIQPCKATUNI-UUYOSTAYSA-N |
| XLogP | 5.31 |
| TPSA | 55.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.89 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|