C15H22O — CID 91746681
6-methyl-4-propan-2-yl-3,4,4a,7,8,8a-hexahydronaphthalene-1-carbaldehyde (PubChem CID 91746681) has the molecular formula C15H22O and a molecular weight of 218.34 g/mol. Its IUPAC name is 6-methyl-4-propan-2-yl-3,4,4a,7,8,8a-hexahydronaphthalene-1-carbaldehyde.
| Compound Name | 6-methyl-4-propan-2-yl-3,4,4a,7,8,8a-hexahydronaphthalene-1-carbaldehyde |
|---|---|
| PubChem CID | 91746681 |
| Molecular Formula | C15H22O |
| Molecular Weight | 218.34 g/mol |
| Exact Mass | 218.17 |
| IUPAC Name | 6-methyl-4-propan-2-yl-3,4,4a,7,8,8a-hexahydronaphthalene-1-carbaldehyde |
| SMILES | CC1=CC2C(CC1)C(C=O)=CCC2C(C)C |
| InChI | InChI=1S/C15H22O/c1-10(2)13-7-5-12(9-16)14-6-4-11(3)8-15(13)14/h5,8-10,13-15H,4,6-7H2,1-3H3 |
| InChIKey | DNHAZRYDTSOZHV-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.34 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|