C11H8F5NO — CID 91746720
(E)-N-[(2,3,4,5,6-pentafluorophenyl)methoxy]but-2-en-1-imine (PubChem CID 91746720) has the molecular formula C11H8F5NO and a molecular weight of 265.18 g/mol. Its IUPAC name is (E)-N-[(2,3,4,5,6-pentafluorophenyl)methoxy]but-2-en-1-imine.
| Compound Name | (E)-N-[(2,3,4,5,6-pentafluorophenyl)methoxy]but-2-en-1-imine |
|---|---|
| PubChem CID | 91746720 |
| Molecular Formula | C11H8F5NO |
| Molecular Weight | 265.18 g/mol |
| Exact Mass | 265.05 |
| IUPAC Name | (E)-N-[(2,3,4,5,6-pentafluorophenyl)methoxy]but-2-en-1-imine |
| SMILES | C/C=C/C=NOCc1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C11H8F5NO/c1-2-3-4-17-18-5-6-7(12)9(14)11(16)10(15)8(6)13/h2-4H,5H2,1H3/b3-2+,17-4? |
| InChIKey | QNPFFCQTVXPCLD-ZBUYTABWSA-N |
| XLogP | 3.46 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.18 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|