C13H16F7N5O2 — CID 91746757
N-[4-(ethylamino)-6-methoxy-1,3,5-triazin-2-yl]-2,2,3,3,4,4,4-heptafluoro-N-propan-2-ylbutanamide (PubChem CID 91746757) has the molecular formula C13H16F7N5O2 and a molecular weight of 407.29 g/mol. Its IUPAC name is N-[4-(ethylamino)-6-methoxy-1,3,5-triazin-2-yl]-2,2,3,3,4,4,4-heptafluoro-N-propan-2-ylbutanamide.
| Compound Name | N-[4-(ethylamino)-6-methoxy-1,3,5-triazin-2-yl]-2,2,3,3,4,4,4-heptafluoro-N-propan-2-ylbutanamide |
|---|---|
| PubChem CID | 91746757 |
| Molecular Formula | C13H16F7N5O2 |
| Molecular Weight | 407.29 g/mol |
| Exact Mass | 407.12 |
| IUPAC Name | N-[4-(ethylamino)-6-methoxy-1,3,5-triazin-2-yl]-2,2,3,3,4,4,4-heptafluoro-N-propan-2-ylbutanamide |
| SMILES | CCNc1nc(OC)nc(N(C(=O)C(F)(F)C(F)(F)C(F)(F)F)C(C)C)n1 |
| InChI | InChI=1S/C13H16F7N5O2/c1-5-21-8-22-9(24-10(23-8)27-4)25(6(2)3)7(26)11(14,15)12(16,17)13(18,19)20/h6H,5H2,1-4H3,(H,21,22,23,24) |
| InChIKey | XOYOEUGZYFAXQE-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 80.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.29 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|