C28H56O5Si3 — CID 91746944
trimethylsilyl 6-[(1R,2R,3R)-5-oxo-3-trimethylsilyloxy-2-[(E,3S)-3-trimethylsilyloxyoct-1-enyl]cyclopentyl]hexanoate (PubChem CID 91746944) has the molecular formula C28H56O5Si3 and a molecular weight of 557.01 g/mol. Its IUPAC name is trimethylsilyl 6-[(1R,2R,3R)-5-oxo-3-trimethylsilyloxy-2-[(E,3S)-3-trimethylsilyloxyoct-1-enyl]cyclopentyl]hexanoate.
| Compound Name | trimethylsilyl 6-[(1R,2R,3R)-5-oxo-3-trimethylsilyloxy-2-[(E,3S)-3-trimethylsilyloxyoct-1-enyl]cyclopentyl]hexanoate |
|---|---|
| PubChem CID | 91746944 |
| Molecular Formula | C28H56O5Si3 |
| Molecular Weight | 557.01 g/mol |
| Exact Mass | 556.34 |
| IUPAC Name | trimethylsilyl 6-[(1R,2R,3R)-5-oxo-3-trimethylsilyloxy-2-[(E,3S)-3-trimethylsilyloxyoct-1-enyl]cyclopentyl]hexanoate |
| SMILES | CCCCC[C@@H](/C=C/[C@H]1[C@H](O[Si](C)(C)C)CC(=O)[C@@H]1CCCCCC(=O)O[Si](C)(C)C)O[Si](C)(C)C |
| InChI | InChI=1S/C28H56O5Si3/c1-11-12-14-17-23(31-34(2,3)4)20-21-25-24(26(29)22-27(25)32-35(5,6)7)18-15-13-16-19-28(30)33-36(8,9)10/h20-21,23-25,27H,11-19,22H2,1-10H3/b21-20+/t23-,24+,25+,27+/m0/s1 |
| InChIKey | VBQDMCGKBZZHBY-OUIXWIHDSA-N |
| XLogP | 8.10 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.01 |
| LogP ≤ 5 | 8.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|