C24H44O2Si2 — CID 91746952
trimethyl-[[(3R,10S)-10-methyl-3-trimethylsilyloxy-1,2,3,4,5,6,7,8,9,11,12,13,14,15-tetradecahydrocyclopenta[a]phenanthren-17-yl]oxy]silane (PubChem CID 91746952) has the molecular formula C24H44O2Si2 and a molecular weight of 420.79 g/mol. Its IUPAC name is trimethyl-[[(3R,10S)-10-methyl-3-trimethylsilyloxy-1,2,3,4,5,6,7,8,9,11,12,13,14,15-tetradecahydrocyclopenta[a]phenanthren-17-yl]oxy]silane.
| Compound Name | trimethyl-[[(3R,10S)-10-methyl-3-trimethylsilyloxy-1,2,3,4,5,6,7,8,9,11,12,13,14,15-tetradecahydrocyclopenta[a]phenanthren-17-yl]oxy]silane |
|---|---|
| PubChem CID | 91746952 |
| Molecular Formula | C24H44O2Si2 |
| Molecular Weight | 420.79 g/mol |
| Exact Mass | 420.29 |
| IUPAC Name | trimethyl-[[(3R,10S)-10-methyl-3-trimethylsilyloxy-1,2,3,4,5,6,7,8,9,11,12,13,14,15-tetradecahydrocyclopenta[a]phenanthren-17-yl]oxy]silane |
| SMILES | C[C@]12CC[C@@H](O[Si](C)(C)C)CC1CCC1C3CC=C(O[Si](C)(C)C)C3CCC12 |
| InChI | InChI=1S/C24H44O2Si2/c1-24-15-14-18(25-27(2,3)4)16-17(24)8-9-20-19-11-13-23(26-28(5,6)7)21(19)10-12-22(20)24/h13,17-22H,8-12,14-16H2,1-7H3/t17?,18-,19?,20?,21?,22?,24+/m1/s1 |
| InChIKey | BFKAXFHZPIJSPI-WNDDMLJTSA-N |
| XLogP | 7.20 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.79 |
| LogP ≤ 5 | 7.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|