C18H27NO7 — CID 91746996
(1R,4S,5S,6R,16R)-5,6-dihydroxy-6-[(1R)-1-hydroxyethyl]-4-propan-2-yl-2,8-dioxa-13-azatricyclo[8.5.1.013,16]hexadec-10-ene-3,7-dione (PubChem CID 91746996) has the molecular formula C18H27NO7 and a molecular weight of 369.41 g/mol. Its IUPAC name is (1R,4S,5S,6R,16R)-5,6-dihydroxy-6-[(1R)-1-hydroxyethyl]-4-propan-2-yl-2,8-dioxa-13-azatricyclo[8.5.1.013,16]hexadec-10-ene-3,7-dione.
| Compound Name | (1R,4S,5S,6R,16R)-5,6-dihydroxy-6-[(1R)-1-hydroxyethyl]-4-propan-2-yl-2,8-dioxa-13-azatricyclo[8.5.1.013,16]hexadec-10-ene-3,7-dione |
|---|---|
| PubChem CID | 91746996 |
| Molecular Formula | C18H27NO7 |
| Molecular Weight | 369.41 g/mol |
| Exact Mass | 369.18 |
| IUPAC Name | (1R,4S,5S,6R,16R)-5,6-dihydroxy-6-[(1R)-1-hydroxyethyl]-4-propan-2-yl-2,8-dioxa-13-azatricyclo[8.5.1.013,16]hexadec-10-ene-3,7-dione |
| SMILES | CC(C)[C@@H]1C(=O)O[C@@H]2CCN3CC=C(COC(=O)[C@@](O)([C@@H](C)O)[C@H]1O)[C@H]23 |
| InChI | InChI=1S/C18H27NO7/c1-9(2)13-15(21)18(24,10(3)20)17(23)25-8-11-4-6-19-7-5-12(14(11)19)26-16(13)22/h4,9-10,12-15,20-21,24H,5-8H2,1-3H3/t10-,12-,13+,14-,15+,18-/m1/s1 |
| InChIKey | JGQRXNDIMGIXDT-SXJGSTQQSA-N |
| XLogP | -0.79 |
| TPSA | 116.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.41 |
| LogP ≤ 5 | -0.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|