C27H26F12O11 — CID 91747054
[(2S,3S,4R,5S,6S)-3,4,5-tris[(2,2,2-trifluoroacetyl)oxy]-6-[(4Z)-4-(2,6,6-trimethyl-4-oxocyclohex-2-en-1-ylidene)butan-2-yl]oxyoxan-2-yl]methyl 2,2,2-trifluoroacetate (PubChem CID 91747054) has the molecular formula C27H26F12O11 and a molecular weight of 754.47 g/mol. Its IUPAC name is [(2S,3S,4R,5S,6S)-3,4,5-tris[(2,2,2-trifluoroacetyl)oxy]-6-[(4Z)-4-(2,6,6-trimethyl-4-oxocyclohex-2-en-1-ylidene)butan-2-yl]oxyoxan-2-yl]methyl 2,2,2-trifluoroacetate.
| Compound Name | [(2S,3S,4R,5S,6S)-3,4,5-tris[(2,2,2-trifluoroacetyl)oxy]-6-[(4Z)-4-(2,6,6-trimethyl-4-oxocyclohex-2-en-1-ylidene)butan-2-yl]oxyoxan-2-yl]methyl 2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 91747054 |
| Molecular Formula | C27H26F12O11 |
| Molecular Weight | 754.47 g/mol |
| Exact Mass | 754.13 |
| IUPAC Name | [(2S,3S,4R,5S,6S)-3,4,5-tris[(2,2,2-trifluoroacetyl)oxy]-6-[(4Z)-4-(2,6,6-trimethyl-4-oxocyclohex-2-en-1-ylidene)butan-2-yl]oxyoxan-2-yl]methyl 2,2,2-trifluoroacetate |
| SMILES | CC1=CC(=O)CC(C)(C)/C1=C/CC(C)O[C@H]1O[C@@H](COC(=O)C(F)(F)F)[C@H](OC(=O)C(F)(F)F)[C@@H](OC(=O)C(F)(F)F)[C@@H]1OC(=O)C(F)(F)F |
| InChI | InChI=1S/C27H26F12O11/c1-10-7-12(40)8-23(3,4)13(10)6-5-11(2)46-18-17(50-22(44)27(37,38)39)16(49-21(43)26(34,35)36)15(48-20(42)25(31,32)33)14(47-18)9-45-19(41)24(28,29)30/h6-7,11,14-18H,5,8-9H2,1-4H3/b13-6+/t11?,14-,15-,16+,17-,18-/m0/s1 |
| InChIKey | GDLXSXLMGJXZHJ-SOTDGYNESA-N |
| XLogP | 4.91 |
| TPSA | 140.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 754.47 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|