C14H22N2O — CID 91747229
(1S,9S)-12-prop-2-enyl-7,11-diazatricyclo[7.3.1.02,7]tridecan-4-one (PubChem CID 91747229) has the molecular formula C14H22N2O and a molecular weight of 234.34 g/mol. Its IUPAC name is (1S,9S)-12-prop-2-enyl-7,11-diazatricyclo[7.3.1.02,7]tridecan-4-one.
| Compound Name | (1S,9S)-12-prop-2-enyl-7,11-diazatricyclo[7.3.1.02,7]tridecan-4-one |
|---|---|
| PubChem CID | 91747229 |
| Molecular Formula | C14H22N2O |
| Molecular Weight | 234.34 g/mol |
| Exact Mass | 234.17 |
| IUPAC Name | (1S,9S)-12-prop-2-enyl-7,11-diazatricyclo[7.3.1.02,7]tridecan-4-one |
| SMILES | C=CCC1NC[C@@H]2C[C@@H]1C1CC(=O)CCN1C2 |
| InChI | InChI=1S/C14H22N2O/c1-2-3-13-12-6-10(8-15-13)9-16-5-4-11(17)7-14(12)16/h2,10,12-15H,1,3-9H2/t10-,12-,13?,14?/m0/s1 |
| InChIKey | SHZTWMVOBAEJMJ-UZYDLOFFSA-N |
| XLogP | 1.20 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.34 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|