About 3-[(Z)-(3,5-dimethoxyphenyl)methylideneamino]-6-ethylthieno[2,3-d]pyrimidin-4-one
3-[(Z)-(3,5-dimethoxyphenyl)methylideneamino]-6-ethylthieno[2,3-d]pyrimidin-4-one (PubChem CID 9174727) has the molecular formula C17H17N3O3S
and a molecular weight of 343.41 g/mol. Its IUPAC name is 3-[(Z)-(3,5-dimethoxyphenyl)methylideneamino]-6-ethylthieno[2,3-d]pyrimidin-4-one.
Molecular Properties
| Compound Name | 3-[(Z)-(3,5-dimethoxyphenyl)methylideneamino]-6-ethylthieno[2,3-d]pyrimidin-4-one |
| PubChem CID | 9174727 |
| Molecular Formula | C17H17N3O3S |
| Molecular Weight | 343.41 g/mol |
| Exact Mass | 343.10 |
| IUPAC Name | 3-[(Z)-(3,5-dimethoxyphenyl)methylideneamino]-6-ethylthieno[2,3-d]pyrimidin-4-one |
| SMILES | CCc1cc2c(=O)n(/N=C\c3cc(OC)cc(OC)c3)cnc2s1 |
| InChI | InChI=1S/C17H17N3O3S/c1-4-14-8-15-16(24-14)18-10-20(17(15)21)19-9-11-5-12(22-2)7-13(6-11)23-3/h5-10H,4H2,1-3H3/b19-9- |
| InChIKey | CKNSQZPHNFTLFA-OCKHKDLRSA-N |
| XLogP | 2.92 |
| TPSA | 65.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 343.41 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 3-[(Z)-(3,5-dimethoxyphenyl)methylideneamino]-6-ethylthieno[2,3-d]pyrimidin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(Z)-(3,5-dimethoxyphenyl)methylideneamino]-6-ethylthieno[2,3-d]pyrimidin-4-one?
The IUPAC name of 3-[(Z)-(3,5-dimethoxyphenyl)methylideneamino]-6-ethylthieno[2,3-d]pyrimidin-4-one (CID 9174727) is 3-[(Z)-(3,5-dimethoxyphenyl)methylideneamino]-6-ethylthieno[2,3-d]pyrimidin-4-one.
What is the SMILES notation for 3-[(Z)-(3,5-dimethoxyphenyl)methylideneamino]-6-ethylthieno[2,3-d]pyrimidin-4-one?
The canonical SMILES for 3-[(Z)-(3,5-dimethoxyphenyl)methylideneamino]-6-ethylthieno[2,3-d]pyrimidin-4-one is CCc1cc2c(=O)n(/N=C\c3cc(OC)cc(OC)c3)cnc2s1.
What is the InChIKey of 3-[(Z)-(3,5-dimethoxyphenyl)methylideneamino]-6-ethylthieno[2,3-d]pyrimidin-4-one?
The InChIKey is CKNSQZPHNFTLFA-OCKHKDLRSA-N. The full InChI is InChI=1S/C17H17N3O3S/c1-4-14-8-15-16(24-14)18-10-20(17(15)21)19-9-11-5-12(22-2)7-13(6-11)23-3/h5-10H,4H2,1-3H3/b19-9-.
What are the key properties of 3-[(Z)-(3,5-dimethoxyphenyl)methylideneamino]-6-ethylthieno[2,3-d]pyrimidin-4-one?
3-[(Z)-(3,5-dimethoxyphenyl)methylideneamino]-6-ethylthieno[2,3-d]pyrimidin-4-one has a molecular weight of 343.41 g/mol, XLogP of 2.92, 5 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(Z)-(3,5-dimethoxyphenyl)methylideneamino]-6-ethylthieno[2,3-d]pyrimidin-4-one is sourced from PubChem (CID 9174727), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).