C13H24O2 — CID 91747289
3-(3-hydroxybutyl)-2,2,4-trimethylcyclohex-3-en-1-ol (PubChem CID 91747289) has the molecular formula C13H24O2 and a molecular weight of 212.33 g/mol. Its IUPAC name is 3-(3-hydroxybutyl)-2,2,4-trimethylcyclohex-3-en-1-ol.
| Compound Name | 3-(3-hydroxybutyl)-2,2,4-trimethylcyclohex-3-en-1-ol |
|---|---|
| PubChem CID | 91747289 |
| Molecular Formula | C13H24O2 |
| Molecular Weight | 212.33 g/mol |
| Exact Mass | 212.18 |
| IUPAC Name | 3-(3-hydroxybutyl)-2,2,4-trimethylcyclohex-3-en-1-ol |
| SMILES | CC1=C(CCC(C)O)C(C)(C)C(O)CC1 |
| InChI | InChI=1S/C13H24O2/c1-9-5-8-12(15)13(3,4)11(9)7-6-10(2)14/h10,12,14-15H,5-8H2,1-4H3 |
| InChIKey | PCHNRWMSYBNCRR-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.33 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|