C20H36O — CID 91747389
(3R)-5-[(8aS)-2,5,5,8a-tetramethyl-1,4,4a,6,7,8-hexahydronaphthalen-1-yl]-3-methylpentan-1-ol (PubChem CID 91747389) has the molecular formula C20H36O and a molecular weight of 292.51 g/mol. Its IUPAC name is (3R)-5-[(8aS)-2,5,5,8a-tetramethyl-1,4,4a,6,7,8-hexahydronaphthalen-1-yl]-3-methylpentan-1-ol.
| Compound Name | (3R)-5-[(8aS)-2,5,5,8a-tetramethyl-1,4,4a,6,7,8-hexahydronaphthalen-1-yl]-3-methylpentan-1-ol |
|---|---|
| PubChem CID | 91747389 |
| Molecular Formula | C20H36O |
| Molecular Weight | 292.51 g/mol |
| Exact Mass | 292.28 |
| IUPAC Name | (3R)-5-[(8aS)-2,5,5,8a-tetramethyl-1,4,4a,6,7,8-hexahydronaphthalen-1-yl]-3-methylpentan-1-ol |
| SMILES | CC1=CCC2C(C)(C)CCC[C@]2(C)C1CC[C@@H](C)CCO |
| InChI | InChI=1S/C20H36O/c1-15(11-14-21)7-9-17-16(2)8-10-18-19(3,4)12-6-13-20(17,18)5/h8,15,17-18,21H,6-7,9-14H2,1-5H3/t15-,17?,18?,20-/m1/s1 |
| InChIKey | KOHDKFKIPUPNMU-CNXCKVANSA-N |
| XLogP | 5.58 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.51 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|