C13H22O3 — CID 91747484
methyl 2-[(1S,2R)-3-hydroxy-2-[(Z)-pent-2-enyl]cyclopentyl]acetate (PubChem CID 91747484) has the molecular formula C13H22O3 and a molecular weight of 226.32 g/mol. Its IUPAC name is methyl 2-[(1S,2R)-3-hydroxy-2-[(Z)-pent-2-enyl]cyclopentyl]acetate.
| Compound Name | methyl 2-[(1S,2R)-3-hydroxy-2-[(Z)-pent-2-enyl]cyclopentyl]acetate |
|---|---|
| PubChem CID | 91747484 |
| Molecular Formula | C13H22O3 |
| Molecular Weight | 226.32 g/mol |
| Exact Mass | 226.16 |
| IUPAC Name | methyl 2-[(1S,2R)-3-hydroxy-2-[(Z)-pent-2-enyl]cyclopentyl]acetate |
| SMILES | CC/C=C\C[C@H]1C(O)CC[C@H]1CC(=O)OC |
| InChI | InChI=1S/C13H22O3/c1-3-4-5-6-11-10(7-8-12(11)14)9-13(15)16-2/h4-5,10-12,14H,3,6-9H2,1-2H3/b5-4-/t10-,11+,12?/m0/s1 |
| InChIKey | OOYCGMQJIWHWHA-WTSPWBOWSA-N |
| XLogP | 2.29 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.32 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|