C16H26O — CID 91747498
(8aS)-6-(1-methoxypropan-2-yl)-8a-methyl-4-methylidene-1,2,3,4a,5,8-hexahydronaphthalene (PubChem CID 91747498) has the molecular formula C16H26O and a molecular weight of 234.38 g/mol. Its IUPAC name is (8aS)-6-(1-methoxypropan-2-yl)-8a-methyl-4-methylidene-1,2,3,4a,5,8-hexahydronaphthalene.
| Compound Name | (8aS)-6-(1-methoxypropan-2-yl)-8a-methyl-4-methylidene-1,2,3,4a,5,8-hexahydronaphthalene |
|---|---|
| PubChem CID | 91747498 |
| Molecular Formula | C16H26O |
| Molecular Weight | 234.38 g/mol |
| Exact Mass | 234.20 |
| IUPAC Name | (8aS)-6-(1-methoxypropan-2-yl)-8a-methyl-4-methylidene-1,2,3,4a,5,8-hexahydronaphthalene |
| SMILES | C=C1CCC[C@@]2(C)CC=C(C(C)COC)CC12 |
| InChI | InChI=1S/C16H26O/c1-12-6-5-8-16(3)9-7-14(10-15(12)16)13(2)11-17-4/h7,13,15H,1,5-6,8-11H2,2-4H3/t13?,15?,16-/m0/s1 |
| InChIKey | JGJVWKKEHVYBGK-BCLQGDPASA-N |
| XLogP | 4.35 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.38 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|