About [(4S)-4-(6-methylhepta-1,5-dien-2-yl)cyclohexen-1-yl]methanol
[(4S)-4-(6-methylhepta-1,5-dien-2-yl)cyclohexen-1-yl]methanol (PubChem CID 91747530) has the molecular formula C15H24O
and a molecular weight of 220.36 g/mol. Its IUPAC name is [(4S)-4-(6-methylhepta-1,5-dien-2-yl)cyclohexen-1-yl]methanol.
Molecular Properties
| Compound Name | [(4S)-4-(6-methylhepta-1,5-dien-2-yl)cyclohexen-1-yl]methanol |
| PubChem CID | 91747530 |
| Molecular Formula | C15H24O |
| Molecular Weight | 220.36 g/mol |
| Exact Mass | 220.18 |
| IUPAC Name | [(4S)-4-(6-methylhepta-1,5-dien-2-yl)cyclohexen-1-yl]methanol |
| SMILES | C=C(CCC=C(C)C)[C@@H]1CC=C(CO)CC1 |
| InChI | InChI=1S/C15H24O/c1-12(2)5-4-6-13(3)15-9-7-14(11-16)8-10-15/h5,7,15-16H,3-4,6,8-11H2,1-2H3/t15-/m1/s1 |
| InChIKey | AWXTUFPUJSQYGO-OAHLLOKOSA-N |
| XLogP | 4.01 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 220.36 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze [(4S)-4-(6-methylhepta-1,5-dien-2-yl)cyclohexen-1-yl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(4S)-4-(6-methylhepta-1,5-dien-2-yl)cyclohexen-1-yl]methanol?
The IUPAC name of [(4S)-4-(6-methylhepta-1,5-dien-2-yl)cyclohexen-1-yl]methanol (CID 91747530) is [(4S)-4-(6-methylhepta-1,5-dien-2-yl)cyclohexen-1-yl]methanol.
What is the SMILES notation for [(4S)-4-(6-methylhepta-1,5-dien-2-yl)cyclohexen-1-yl]methanol?
The canonical SMILES for [(4S)-4-(6-methylhepta-1,5-dien-2-yl)cyclohexen-1-yl]methanol is C=C(CCC=C(C)C)[C@@H]1CC=C(CO)CC1.
What is the InChIKey of [(4S)-4-(6-methylhepta-1,5-dien-2-yl)cyclohexen-1-yl]methanol?
The InChIKey is AWXTUFPUJSQYGO-OAHLLOKOSA-N. The full InChI is InChI=1S/C15H24O/c1-12(2)5-4-6-13(3)15-9-7-14(11-16)8-10-15/h5,7,15-16H,3-4,6,8-11H2,1-2H3/t15-/m1/s1.
What are the key properties of [(4S)-4-(6-methylhepta-1,5-dien-2-yl)cyclohexen-1-yl]methanol?
[(4S)-4-(6-methylhepta-1,5-dien-2-yl)cyclohexen-1-yl]methanol has a molecular weight of 220.36 g/mol, XLogP of 4.01, 5 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for [(4S)-4-(6-methylhepta-1,5-dien-2-yl)cyclohexen-1-yl]methanol is sourced from PubChem (CID 91747530), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).