C35H84O11Si8 — CID 91747577
(3R,4R,5R)-4-[(3R,4R,5S,6R)-3,4,5,6-tetrakis(trimethylsilyloxy)oxan-2-yl]oxy-1,3,5,6-tetrakis(trimethylsilyloxy)hexan-2-one (PubChem CID 91747577) has the molecular formula C35H84O11Si8 and a molecular weight of 905.73 g/mol. Its IUPAC name is (3R,4R,5R)-4-[(3R,4R,5S,6R)-3,4,5,6-tetrakis(trimethylsilyloxy)oxan-2-yl]oxy-1,3,5,6-tetrakis(trimethylsilyloxy)hexan-2-one.
| Compound Name | (3R,4R,5R)-4-[(3R,4R,5S,6R)-3,4,5,6-tetrakis(trimethylsilyloxy)oxan-2-yl]oxy-1,3,5,6-tetrakis(trimethylsilyloxy)hexan-2-one |
|---|---|
| PubChem CID | 91747577 |
| Molecular Formula | C35H84O11Si8 |
| Molecular Weight | 905.73 g/mol |
| Exact Mass | 904.42 |
| IUPAC Name | (3R,4R,5R)-4-[(3R,4R,5S,6R)-3,4,5,6-tetrakis(trimethylsilyloxy)oxan-2-yl]oxy-1,3,5,6-tetrakis(trimethylsilyloxy)hexan-2-one |
| SMILES | C[Si](C)(C)OCC(=O)[C@H](O[Si](C)(C)C)[C@H](OC1O[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]1O[Si](C)(C)C)[C@@H](CO[Si](C)(C)C)O[Si](C)(C)C |
| InChI | InChI=1S/C35H84O11Si8/c1-47(2,3)37-25-27(36)29(42-50(10,11)12)30(28(41-49(7,8)9)26-38-48(4,5)6)39-34-32(44-52(16,17)18)31(43-51(13,14)15)33(45-53(19,20)21)35(40-34)46-54(22,23)24/h28-35H,25-26H2,1-24H3/t28-,29+,30-,31-,32-,33+,34?,35-/m1/s1 |
| InChIKey | HAMCZNSCSJBQPU-CAUHRGFPSA-N |
| XLogP | 9.28 |
| TPSA | 109.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 54 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 905.73 |
| LogP ≤ 5 | 9.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|