C14H6Cl2F6N2O3 — CID 91747685
(2,3,4,5,6-pentafluorophenyl)methyl 2-[(4-amino-3,5-dichloro-6-fluoro-2-pyridinyl)oxy]acetate (PubChem CID 91747685) has the molecular formula C14H6Cl2F6N2O3 and a molecular weight of 435.11 g/mol. Its IUPAC name is (2,3,4,5,6-pentafluorophenyl)methyl 2-[(4-amino-3,5-dichloro-6-fluoro-2-pyridinyl)oxy]acetate.
| Compound Name | (2,3,4,5,6-pentafluorophenyl)methyl 2-[(4-amino-3,5-dichloro-6-fluoro-2-pyridinyl)oxy]acetate |
|---|---|
| PubChem CID | 91747685 |
| Molecular Formula | C14H6Cl2F6N2O3 |
| Molecular Weight | 435.11 g/mol |
| Exact Mass | 433.97 |
| IUPAC Name | (2,3,4,5,6-pentafluorophenyl)methyl 2-[(4-amino-3,5-dichloro-6-fluoro-2-pyridinyl)oxy]acetate |
| SMILES | Nc1c(Cl)c(F)nc(OCC(=O)OCc2c(F)c(F)c(F)c(F)c2F)c1Cl |
| InChI | InChI=1S/C14H6Cl2F6N2O3/c15-5-12(23)6(16)14(24-13(5)22)27-2-4(25)26-1-3-7(17)9(19)11(21)10(20)8(3)18/h1-2H2,(H2,23,24) |
| InChIKey | DFEVWDQRLPYBIG-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 74.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.11 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|