C30H54O2Si — CID 91747705
[(5S,7S,9R)-2,16-dimethyl-15-(6-methylheptan-2-yl)-8-oxapentacyclo[9.7.0.02,7.07,9.012,16]octadecan-5-yl]oxy-trimethylsilane (PubChem CID 91747705) has the molecular formula C30H54O2Si and a molecular weight of 474.85 g/mol. Its IUPAC name is [(5S,7S,9R)-2,16-dimethyl-15-(6-methylheptan-2-yl)-8-oxapentacyclo[9.7.0.02,7.07,9.012,16]octadecan-5-yl]oxy-trimethylsilane.
| Compound Name | [(5S,7S,9R)-2,16-dimethyl-15-(6-methylheptan-2-yl)-8-oxapentacyclo[9.7.0.02,7.07,9.012,16]octadecan-5-yl]oxy-trimethylsilane |
|---|---|
| PubChem CID | 91747705 |
| Molecular Formula | C30H54O2Si |
| Molecular Weight | 474.85 g/mol |
| Exact Mass | 474.39 |
| IUPAC Name | [(5S,7S,9R)-2,16-dimethyl-15-(6-methylheptan-2-yl)-8-oxapentacyclo[9.7.0.02,7.07,9.012,16]octadecan-5-yl]oxy-trimethylsilane |
| SMILES | CC(C)CCCC(C)C1CCC2C3C[C@H]4O[C@]45C[C@@H](O[Si](C)(C)C)CCC5(C)C3CCC12C |
| InChI | InChI=1S/C30H54O2Si/c1-20(2)10-9-11-21(3)24-12-13-25-23-18-27-30(31-27)19-22(32-33(6,7)8)14-17-29(30,5)26(23)15-16-28(24,25)4/h20-27H,9-19H2,1-8H3/t21?,22-,23?,24?,25?,26?,27+,28?,29?,30+/m0/s1 |
| InChIKey | AZHUYKSUWGBLAU-IQKDCUDUSA-N |
| XLogP | 8.46 |
| TPSA | 21.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.85 |
| LogP ≤ 5 | 8.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|