C12H28O3Si2 — CID 91747803
trimethylsilyl (2S,3R)-2-methyl-3-trimethylsilyloxypentanoate (PubChem CID 91747803) has the molecular formula C12H28O3Si2 and a molecular weight of 276.52 g/mol. Its IUPAC name is trimethylsilyl (2S,3R)-2-methyl-3-trimethylsilyloxypentanoate.
| Compound Name | trimethylsilyl (2S,3R)-2-methyl-3-trimethylsilyloxypentanoate |
|---|---|
| PubChem CID | 91747803 |
| Molecular Formula | C12H28O3Si2 |
| Molecular Weight | 276.52 g/mol |
| Exact Mass | 276.16 |
| IUPAC Name | trimethylsilyl (2S,3R)-2-methyl-3-trimethylsilyloxypentanoate |
| SMILES | CC[C@@H](O[Si](C)(C)C)[C@H](C)C(=O)O[Si](C)(C)C |
| InChI | InChI=1S/C12H28O3Si2/c1-9-11(14-16(3,4)5)10(2)12(13)15-17(6,7)8/h10-11H,9H2,1-8H3/t10-,11+/m0/s1 |
| InChIKey | NYQQSMMILUJHAT-WDEREUQCSA-N |
| XLogP | 3.63 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.52 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|