About 3-tert-butyl-N,N,1-trimethyl-4-nitropyrazole-5-carboxamide
3-tert-butyl-N,N,1-trimethyl-4-nitropyrazole-5-carboxamide (PubChem CID 917480) has the molecular formula C11H18N4O3
and a molecular weight of 254.29 g/mol. Its IUPAC name is 3-tert-butyl-N,N,1-trimethyl-4-nitropyrazole-5-carboxamide.
Molecular Properties
| Compound Name | 3-tert-butyl-N,N,1-trimethyl-4-nitropyrazole-5-carboxamide |
| PubChem CID | 917480 |
| Molecular Formula | C11H18N4O3 |
| Molecular Weight | 254.29 g/mol |
| Exact Mass | 254.14 |
| IUPAC Name | 3-tert-butyl-N,N,1-trimethyl-4-nitropyrazole-5-carboxamide |
| SMILES | CN(C)C(=O)c1c([N+](=O)[O-])c(C(C)(C)C)nn1C |
| InChI | InChI=1S/C11H18N4O3/c1-11(2,3)9-7(15(17)18)8(14(6)12-9)10(16)13(4)5/h1-6H3 |
| InChIKey | GUGUBOHHPFKODY-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 81.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 254.29 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 3-tert-butyl-N,N,1-trimethyl-4-nitropyrazole-5-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-tert-butyl-N,N,1-trimethyl-4-nitropyrazole-5-carboxamide?
The IUPAC name of 3-tert-butyl-N,N,1-trimethyl-4-nitropyrazole-5-carboxamide (CID 917480) is 3-tert-butyl-N,N,1-trimethyl-4-nitropyrazole-5-carboxamide.
What is the SMILES notation for 3-tert-butyl-N,N,1-trimethyl-4-nitropyrazole-5-carboxamide?
The canonical SMILES for 3-tert-butyl-N,N,1-trimethyl-4-nitropyrazole-5-carboxamide is CN(C)C(=O)c1c([N+](=O)[O-])c(C(C)(C)C)nn1C.
What is the InChIKey of 3-tert-butyl-N,N,1-trimethyl-4-nitropyrazole-5-carboxamide?
The InChIKey is GUGUBOHHPFKODY-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H18N4O3/c1-11(2,3)9-7(15(17)18)8(14(6)12-9)10(16)13(4)5/h1-6H3.
What are the key properties of 3-tert-butyl-N,N,1-trimethyl-4-nitropyrazole-5-carboxamide?
3-tert-butyl-N,N,1-trimethyl-4-nitropyrazole-5-carboxamide has a molecular weight of 254.29 g/mol, XLogP of 1.33, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-tert-butyl-N,N,1-trimethyl-4-nitropyrazole-5-carboxamide is sourced from PubChem (CID 917480), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).