C13H24O2 — CID 91748018
(2R,4R)-2-[(E)-2,6-dimethylhept-3-en-3-yl]-4-methyl-1,3-dioxolane (PubChem CID 91748018) has the molecular formula C13H24O2 and a molecular weight of 212.33 g/mol. Its IUPAC name is (2R,4R)-2-[(E)-2,6-dimethylhept-3-en-3-yl]-4-methyl-1,3-dioxolane.
| Compound Name | (2R,4R)-2-[(E)-2,6-dimethylhept-3-en-3-yl]-4-methyl-1,3-dioxolane |
|---|---|
| PubChem CID | 91748018 |
| Molecular Formula | C13H24O2 |
| Molecular Weight | 212.33 g/mol |
| Exact Mass | 212.18 |
| IUPAC Name | (2R,4R)-2-[(E)-2,6-dimethylhept-3-en-3-yl]-4-methyl-1,3-dioxolane |
| SMILES | CC(C)C/C=C(\C(C)C)[C@@H]1OC[C@@H](C)O1 |
| InChI | InChI=1S/C13H24O2/c1-9(2)6-7-12(10(3)4)13-14-8-11(5)15-13/h7,9-11,13H,6,8H2,1-5H3/b12-7+/t11-,13-/m1/s1 |
| InChIKey | BVEUITQPSRGKBL-ZGPXNKBISA-N |
| XLogP | 3.38 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.33 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|