About 2-butylideneadamantane
2-butylideneadamantane (PubChem CID 91748048) has the molecular formula C14H22
and a molecular weight of 190.33 g/mol. Its IUPAC name is 2-butylideneadamantane.
Molecular Properties
| Compound Name | 2-butylideneadamantane |
| PubChem CID | 91748048 |
| Molecular Formula | C14H22 |
| Molecular Weight | 190.33 g/mol |
| Exact Mass | 190.17 |
| IUPAC Name | 2-butylideneadamantane |
| SMILES | CCCC=C1C2CC3CC(C2)CC1C3 |
| InChI | InChI=1S/C14H22/c1-2-3-4-14-12-6-10-5-11(8-12)9-13(14)7-10/h4,10-13H,2-3,5-9H2,1H3/b14-4- |
| InChIKey | QYYRVPQXQWMSSI-CPSFFCFKSA-N |
| XLogP | 4.17 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 190.33 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-butylideneadamantane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-butylideneadamantane?
The IUPAC name of 2-butylideneadamantane (CID 91748048) is 2-butylideneadamantane.
What is the SMILES notation for 2-butylideneadamantane?
The canonical SMILES for 2-butylideneadamantane is CCCC=C1C2CC3CC(C2)CC1C3.
What is the InChIKey of 2-butylideneadamantane?
The InChIKey is QYYRVPQXQWMSSI-CPSFFCFKSA-N. The full InChI is InChI=1S/C14H22/c1-2-3-4-14-12-6-10-5-11(8-12)9-13(14)7-10/h4,10-13H,2-3,5-9H2,1H3/b14-4-.
What are the key properties of 2-butylideneadamantane?
2-butylideneadamantane has a molecular weight of 190.33 g/mol, XLogP of 4.17, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 2-butylideneadamantane is sourced from PubChem (CID 91748048), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).