About [(Z)-hex-3-enyl] 3-hydroxybutanoate
[(Z)-hex-3-enyl] 3-hydroxybutanoate (PubChem CID 91748130) has the molecular formula C10H18O3
and a molecular weight of 186.25 g/mol. Its IUPAC name is [(Z)-hex-3-enyl] 3-hydroxybutanoate.
Molecular Properties
| Compound Name | [(Z)-hex-3-enyl] 3-hydroxybutanoate |
| PubChem CID | 91748130 |
| Molecular Formula | C10H18O3 |
| Molecular Weight | 186.25 g/mol |
| Exact Mass | 186.13 |
| IUPAC Name | [(Z)-hex-3-enyl] 3-hydroxybutanoate |
| SMILES | CC/C=C\CCOC(=O)CC(C)O |
| InChI | InChI=1S/C10H18O3/c1-3-4-5-6-7-13-10(12)8-9(2)11/h4-5,9,11H,3,6-8H2,1-2H3/b5-4- |
| InChIKey | YCRZFZCDOSZRKH-PLNGDYQASA-N |
| XLogP | 1.66 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 186.25 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze [(Z)-hex-3-enyl] 3-hydroxybutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(Z)-hex-3-enyl] 3-hydroxybutanoate?
The IUPAC name of [(Z)-hex-3-enyl] 3-hydroxybutanoate (CID 91748130) is [(Z)-hex-3-enyl] 3-hydroxybutanoate.
What is the SMILES notation for [(Z)-hex-3-enyl] 3-hydroxybutanoate?
The canonical SMILES for [(Z)-hex-3-enyl] 3-hydroxybutanoate is CC/C=C\CCOC(=O)CC(C)O.
What is the InChIKey of [(Z)-hex-3-enyl] 3-hydroxybutanoate?
The InChIKey is YCRZFZCDOSZRKH-PLNGDYQASA-N. The full InChI is InChI=1S/C10H18O3/c1-3-4-5-6-7-13-10(12)8-9(2)11/h4-5,9,11H,3,6-8H2,1-2H3/b5-4-.
What are the key properties of [(Z)-hex-3-enyl] 3-hydroxybutanoate?
[(Z)-hex-3-enyl] 3-hydroxybutanoate has a molecular weight of 186.25 g/mol, XLogP of 1.66, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [(Z)-hex-3-enyl] 3-hydroxybutanoate is sourced from PubChem (CID 91748130), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).