C26H29NO6 — CID 91748208
[1-[3-[acetyl(methyl)amino]propyl]-12-acetyloxy-10-hydroxy-4-tetracyclo[6.6.2.02,7.09,14]hexadeca-2(7),3,5,9(14),10,12-hexaenyl] acetate (PubChem CID 91748208) has the molecular formula C26H29NO6 and a molecular weight of 451.52 g/mol. Its IUPAC name is [1-[3-[acetyl(methyl)amino]propyl]-12-acetyloxy-10-hydroxy-4-tetracyclo[6.6.2.02,7.09,14]hexadeca-2(7),3,5,9(14),10,12-hexaenyl] acetate.
| Compound Name | [1-[3-[acetyl(methyl)amino]propyl]-12-acetyloxy-10-hydroxy-4-tetracyclo[6.6.2.02,7.09,14]hexadeca-2(7),3,5,9(14),10,12-hexaenyl] acetate |
|---|---|
| PubChem CID | 91748208 |
| Molecular Formula | C26H29NO6 |
| Molecular Weight | 451.52 g/mol |
| Exact Mass | 451.20 |
| IUPAC Name | [1-[3-[acetyl(methyl)amino]propyl]-12-acetyloxy-10-hydroxy-4-tetracyclo[6.6.2.02,7.09,14]hexadeca-2(7),3,5,9(14),10,12-hexaenyl] acetate |
| SMILES | CC(=O)Oc1ccc2c(c1)C1(CCCN(C)C(C)=O)CCC2c2c(O)cc(OC(C)=O)cc21 |
| InChI | InChI=1S/C26H29NO6/c1-15(28)27(4)11-5-9-26-10-8-21(20-7-6-18(12-22(20)26)32-16(2)29)25-23(26)13-19(14-24(25)31)33-17(3)30/h6-7,12-14,21,31H,5,8-11H2,1-4H3 |
| InChIKey | HLYOUXWTOSSKQS-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 93.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.52 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|