C33H54O2 — CID 91748241
[(3S,5R,10S,13S,14S,17S)-17-[(E,2S)-5,6-dimethylhept-4-en-2-yl]-4,4,10,13,14-pentamethyl-2,3,5,6,7,11,12,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-3-yl] acetate (PubChem CID 91748241) has the molecular formula C33H54O2 and a molecular weight of 482.79 g/mol. Its IUPAC name is [(3S,5R,10S,13S,14S,17S)-17-[(E,2S)-5,6-dimethylhept-4-en-2-yl]-4,4,10,13,14-pentamethyl-2,3,5,6,7,11,12,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-3-yl] acetate.
| Compound Name | [(3S,5R,10S,13S,14S,17S)-17-[(E,2S)-5,6-dimethylhept-4-en-2-yl]-4,4,10,13,14-pentamethyl-2,3,5,6,7,11,12,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-3-yl] acetate |
|---|---|
| PubChem CID | 91748241 |
| Molecular Formula | C33H54O2 |
| Molecular Weight | 482.79 g/mol |
| Exact Mass | 482.41 |
| IUPAC Name | [(3S,5R,10S,13S,14S,17S)-17-[(E,2S)-5,6-dimethylhept-4-en-2-yl]-4,4,10,13,14-pentamethyl-2,3,5,6,7,11,12,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-3-yl] acetate |
| SMILES | CC(=O)O[C@H]1CC[C@]2(C)C3=C(CC[C@H]2C1(C)C)[C@@]1(C)CC[C@@H]([C@@H](C)C/C=C(\C)C(C)C)[C@]1(C)CC3 |
| InChI | InChI=1S/C33H54O2/c1-21(2)22(3)11-12-23(4)25-15-19-33(10)27-13-14-28-30(6,7)29(35-24(5)34)17-18-31(28,8)26(27)16-20-32(25,33)9/h11,21,23,25,28-29H,12-20H2,1-10H3/b22-11+/t23-,25-,28-,29-,31+,32-,33+/m0/s1 |
| InChIKey | DJFUFRXAOIPMAV-PVSYPZCSSA-N |
| XLogP | 9.30 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.79 |
| LogP ≤ 5 | 9.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|