About (4Z)-4-(furan-2-ylmethylidene)-2,3-dihydropyrrole
(4Z)-4-(furan-2-ylmethylidene)-2,3-dihydropyrrole (PubChem CID 91748325) has the molecular formula C9H9NO
and a molecular weight of 147.18 g/mol. Its IUPAC name is (4Z)-4-(furan-2-ylmethylidene)-2,3-dihydropyrrole.
Molecular Properties
| Compound Name | (4Z)-4-(furan-2-ylmethylidene)-2,3-dihydropyrrole |
| PubChem CID | 91748325 |
| Molecular Formula | C9H9NO |
| Molecular Weight | 147.18 g/mol |
| Exact Mass | 147.07 |
| IUPAC Name | (4Z)-4-(furan-2-ylmethylidene)-2,3-dihydropyrrole |
| SMILES | C1=NCC/C1=C/c1ccco1 |
| InChI | InChI=1S/C9H9NO/c1-2-9(11-5-1)6-8-3-4-10-7-8/h1-2,5-7H,3-4H2/b8-6- |
| InChIKey | UEGNEKZXKDRCHZ-VURMDHGXSA-N |
| XLogP | 2.14 |
| TPSA | 25.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 147.18 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (4Z)-4-(furan-2-ylmethylidene)-2,3-dihydropyrrole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4Z)-4-(furan-2-ylmethylidene)-2,3-dihydropyrrole?
The IUPAC name of (4Z)-4-(furan-2-ylmethylidene)-2,3-dihydropyrrole (CID 91748325) is (4Z)-4-(furan-2-ylmethylidene)-2,3-dihydropyrrole.
What is the SMILES notation for (4Z)-4-(furan-2-ylmethylidene)-2,3-dihydropyrrole?
The canonical SMILES for (4Z)-4-(furan-2-ylmethylidene)-2,3-dihydropyrrole is C1=NCC/C1=C/c1ccco1.
What is the InChIKey of (4Z)-4-(furan-2-ylmethylidene)-2,3-dihydropyrrole?
The InChIKey is UEGNEKZXKDRCHZ-VURMDHGXSA-N. The full InChI is InChI=1S/C9H9NO/c1-2-9(11-5-1)6-8-3-4-10-7-8/h1-2,5-7H,3-4H2/b8-6-.
What are the key properties of (4Z)-4-(furan-2-ylmethylidene)-2,3-dihydropyrrole?
(4Z)-4-(furan-2-ylmethylidene)-2,3-dihydropyrrole has a molecular weight of 147.18 g/mol, XLogP of 2.14, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (4Z)-4-(furan-2-ylmethylidene)-2,3-dihydropyrrole is sourced from PubChem (CID 91748325), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).