About trimethylsilyl (3R)-3-methyl-3,5-bis(trimethylsilyloxy)pentanoate
trimethylsilyl (3R)-3-methyl-3,5-bis(trimethylsilyloxy)pentanoate (PubChem CID 91748333) has the molecular formula C15H36O4Si3
and a molecular weight of 364.71 g/mol. Its IUPAC name is trimethylsilyl (3R)-3-methyl-3,5-bis(trimethylsilyloxy)pentanoate.
Molecular Properties
| Compound Name | trimethylsilyl (3R)-3-methyl-3,5-bis(trimethylsilyloxy)pentanoate |
| PubChem CID | 91748333 |
| Molecular Formula | C15H36O4Si3 |
| Molecular Weight | 364.71 g/mol |
| Exact Mass | 364.19 |
| IUPAC Name | trimethylsilyl (3R)-3-methyl-3,5-bis(trimethylsilyloxy)pentanoate |
| SMILES | C[C@@](CCO[Si](C)(C)C)(CC(=O)O[Si](C)(C)C)O[Si](C)(C)C |
| InChI | InChI=1S/C15H36O4Si3/c1-15(19-22(8,9)10,11-12-17-20(2,3)4)13-14(16)18-21(5,6)7/h11-13H2,1-10H3/t15-/m1/s1 |
| InChIKey | HUAKLDAFGDRXAP-OAHLLOKOSA-N |
| XLogP | 4.61 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 364.71 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze trimethylsilyl (3R)-3-methyl-3,5-bis(trimethylsilyloxy)pentanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of trimethylsilyl (3R)-3-methyl-3,5-bis(trimethylsilyloxy)pentanoate?
The IUPAC name of trimethylsilyl (3R)-3-methyl-3,5-bis(trimethylsilyloxy)pentanoate (CID 91748333) is trimethylsilyl (3R)-3-methyl-3,5-bis(trimethylsilyloxy)pentanoate.
What is the SMILES notation for trimethylsilyl (3R)-3-methyl-3,5-bis(trimethylsilyloxy)pentanoate?
The canonical SMILES for trimethylsilyl (3R)-3-methyl-3,5-bis(trimethylsilyloxy)pentanoate is C[C@@](CCO[Si](C)(C)C)(CC(=O)O[Si](C)(C)C)O[Si](C)(C)C.
What is the InChIKey of trimethylsilyl (3R)-3-methyl-3,5-bis(trimethylsilyloxy)pentanoate?
The InChIKey is HUAKLDAFGDRXAP-OAHLLOKOSA-N. The full InChI is InChI=1S/C15H36O4Si3/c1-15(19-22(8,9)10,11-12-17-20(2,3)4)13-14(16)18-21(5,6)7/h11-13H2,1-10H3/t15-/m1/s1.
What are the key properties of trimethylsilyl (3R)-3-methyl-3,5-bis(trimethylsilyloxy)pentanoate?
trimethylsilyl (3R)-3-methyl-3,5-bis(trimethylsilyloxy)pentanoate has a molecular weight of 364.71 g/mol, XLogP of 4.61, 9 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for trimethylsilyl (3R)-3-methyl-3,5-bis(trimethylsilyloxy)pentanoate is sourced from PubChem (CID 91748333), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).