C28H52O3Si3 — CID 91748390
[(5R,6R,10R,13S)-10,13-dimethyl-3,6-bis(trimethylsilyloxy)-4,5,6,7,8,9,11,12,14,15-decahydro-1H-cyclopenta[a]phenanthren-17-yl]oxy-trimethylsilane (PubChem CID 91748390) has the molecular formula C28H52O3Si3 and a molecular weight of 520.98 g/mol. Its IUPAC name is [(5R,6R,10R,13S)-10,13-dimethyl-3,6-bis(trimethylsilyloxy)-4,5,6,7,8,9,11,12,14,15-decahydro-1H-cyclopenta[a]phenanthren-17-yl]oxy-trimethylsilane.
| Compound Name | [(5R,6R,10R,13S)-10,13-dimethyl-3,6-bis(trimethylsilyloxy)-4,5,6,7,8,9,11,12,14,15-decahydro-1H-cyclopenta[a]phenanthren-17-yl]oxy-trimethylsilane |
|---|---|
| PubChem CID | 91748390 |
| Molecular Formula | C28H52O3Si3 |
| Molecular Weight | 520.98 g/mol |
| Exact Mass | 520.32 |
| IUPAC Name | [(5R,6R,10R,13S)-10,13-dimethyl-3,6-bis(trimethylsilyloxy)-4,5,6,7,8,9,11,12,14,15-decahydro-1H-cyclopenta[a]phenanthren-17-yl]oxy-trimethylsilane |
| SMILES | C[C@]12CCC3C(C[C@@H](O[Si](C)(C)C)[C@@H]4CC(O[Si](C)(C)C)=CC[C@]34C)C1CC=C2O[Si](C)(C)C |
| InChI | InChI=1S/C28H52O3Si3/c1-27-16-14-20(29-32(3,4)5)18-24(27)25(30-33(6,7)8)19-21-22-12-13-26(31-34(9,10)11)28(22,2)17-15-23(21)27/h13-14,21-25H,12,15-19H2,1-11H3/t21?,22?,23?,24-,25+,27+,28-/m0/s1 |
| InChIKey | ZNMLKZDNEJOGCO-FSFWVJRDSA-N |
| XLogP | 8.55 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.98 |
| LogP ≤ 5 | 8.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|