C13H13ClN2O2 — CID 917484
4-[(4-chloro-3,5-dimethylpyrazol-1-yl)methyl]benzoic acid (PubChem CID 917484) has the molecular formula C13H13ClN2O2 and a molecular weight of 264.71 g/mol. Its IUPAC name is 4-[(4-chloro-3,5-dimethylpyrazol-1-yl)methyl]benzoic acid.
| Compound Name | 4-[(4-chloro-3,5-dimethylpyrazol-1-yl)methyl]benzoic acid |
|---|---|
| PubChem CID | 917484 |
| Molecular Formula | C13H13ClN2O2 |
| Molecular Weight | 264.71 g/mol |
| Exact Mass | 264.07 |
| IUPAC Name | 4-[(4-chloro-3,5-dimethylpyrazol-1-yl)methyl]benzoic acid |
| SMILES | Cc1nn(Cc2ccc(C(=O)O)cc2)c(C)c1Cl |
| InChI | InChI=1S/C13H13ClN2O2/c1-8-12(14)9(2)16(15-8)7-10-3-5-11(6-4-10)13(17)18/h3-6H,7H2,1-2H3,(H,17,18) |
| InChIKey | XVELFNFMFLZCEM-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.71 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |