C12H11F8NO4 — CID 91748435
2,2,2-trifluoroethyl 2-[[(E)-2-methylbut-2-enoyl]-(2,2,3,3,3-pentafluoropropanoyl)amino]acetate (PubChem CID 91748435) has the molecular formula C12H11F8NO4 and a molecular weight of 385.21 g/mol. Its IUPAC name is 2,2,2-trifluoroethyl 2-[[(E)-2-methylbut-2-enoyl]-(2,2,3,3,3-pentafluoropropanoyl)amino]acetate.
| Compound Name | 2,2,2-trifluoroethyl 2-[[(E)-2-methylbut-2-enoyl]-(2,2,3,3,3-pentafluoropropanoyl)amino]acetate |
|---|---|
| PubChem CID | 91748435 |
| Molecular Formula | C12H11F8NO4 |
| Molecular Weight | 385.21 g/mol |
| Exact Mass | 385.06 |
| IUPAC Name | 2,2,2-trifluoroethyl 2-[[(E)-2-methylbut-2-enoyl]-(2,2,3,3,3-pentafluoropropanoyl)amino]acetate |
| SMILES | C/C=C(\C)C(=O)N(CC(=O)OCC(F)(F)F)C(=O)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C12H11F8NO4/c1-3-6(2)8(23)21(4-7(22)25-5-10(13,14)15)9(24)11(16,17)12(18,19)20/h3H,4-5H2,1-2H3/b6-3+ |
| InChIKey | YGOWRRJLAATVEP-ZZXKWVIFSA-N |
| XLogP | 2.61 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.21 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|